C21H17F6NO3S — CID 54044273
3-[4-(2-hydroxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 54044273) has the molecular formula C21H17F6NO3S and a molecular weight of 477.43 g/mol. Its IUPAC name is 3-[4-(2-hydroxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[4-(2-hydroxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 54044273 |
| Molecular Formula | C21H17F6NO3S |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-[4-(2-hydroxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Sc2ccccc2O)c(C(F)(F)F)c1C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C21H17F6NO3S/c22-20(23,24)18-13(6-8-17(30)28-9-11-31-12-10-28)5-7-16(19(18)21(25,26)27)32-15-4-2-1-3-14(15)29/h1-8,29H,9-12H2 |
| InChIKey | LOLWQKJEXPYLLH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|