C29H35Cl2N3O4S — CID 20765554
1-[3-[2,3-dichloro-4-[(E)-3-[4-(2-ethoxyethyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid (PubChem CID 20765554) has the molecular formula C29H35Cl2N3O4S and a molecular weight of 592.59 g/mol. Its IUPAC name is 1-[3-[2,3-dichloro-4-[(E)-3-[4-(2-ethoxyethyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[2,3-dichloro-4-[(E)-3-[4-(2-ethoxyethyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20765554 |
| Molecular Formula | C29H35Cl2N3O4S |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | 1-[3-[2,3-dichloro-4-[(E)-3-[4-(2-ethoxyethyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid |
| SMILES | CCOCCN1CCN(C(=O)/C=C/c2ccc(Sc3cccc(N4CCC(C(=O)O)CC4)c3)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C29H35Cl2N3O4S/c1-2-38-19-18-32-14-16-34(17-15-32)26(35)9-7-21-6-8-25(28(31)27(21)30)39-24-5-3-4-23(20-24)33-12-10-22(11-13-33)29(36)37/h3-9,20,22H,2,10-19H2,1H3,(H,36,37)/b9-7+ |
| InChIKey | AYPVANXOWDQXOV-VQHVLOKHSA-N |
| XLogP | 5.64 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|