C27H33Cl2N5O5S2 — CID 22498400
1-[3-[2,3-dichloro-4-[3-[4-(dimethylaminosulfamoyl)piperazin-1-yl]-3-oxoprop-1-en-2-yl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid (PubChem CID 22498400) has the molecular formula C27H33Cl2N5O5S2 and a molecular weight of 642.63 g/mol. Its IUPAC name is 1-[3-[2,3-dichloro-4-[3-[4-(dimethylaminosulfamoyl)piperazin-1-yl]-3-oxoprop-1-en-2-yl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[2,3-dichloro-4-[3-[4-(dimethylaminosulfamoyl)piperazin-1-yl]-3-oxoprop-1-en-2-yl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22498400 |
| Molecular Formula | C27H33Cl2N5O5S2 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | 1-[3-[2,3-dichloro-4-[3-[4-(dimethylaminosulfamoyl)piperazin-1-yl]-3-oxoprop-1-en-2-yl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid |
| SMILES | C=C(C(=O)N1CCN(S(=O)(=O)NN(C)C)CC1)c1ccc(Sc2cccc(N3CCC(C(=O)O)CC3)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C27H33Cl2N5O5S2/c1-18(26(35)33-13-15-34(16-14-33)41(38,39)30-31(2)3)22-7-8-23(25(29)24(22)28)40-21-6-4-5-20(17-21)32-11-9-19(10-12-32)27(36)37/h4-8,17,19,30H,1,9-16H2,2-3H3,(H,36,37) |
| InChIKey | QZTKWFNOOGLQPJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|