C26H26Cl2F3N3O3S2 — CID 163799972
1-[3-[2,3-dichloro-4-[3-oxo-3-[4-(trifluoromethylsulfanyl)piperazin-1-yl]prop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid (PubChem CID 163799972) has the molecular formula C26H26Cl2F3N3O3S2 and a molecular weight of 620.55 g/mol. Its IUPAC name is 1-[3-[2,3-dichloro-4-[3-oxo-3-[4-(trifluoromethylsulfanyl)piperazin-1-yl]prop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[2,3-dichloro-4-[3-oxo-3-[4-(trifluoromethylsulfanyl)piperazin-1-yl]prop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 163799972 |
| Molecular Formula | C26H26Cl2F3N3O3S2 |
| Molecular Weight | 620.55 g/mol |
| Exact Mass | 619.07 |
| IUPAC Name | 1-[3-[2,3-dichloro-4-[3-oxo-3-[4-(trifluoromethylsulfanyl)piperazin-1-yl]prop-1-enyl]phenyl]sulfanylphenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2cccc(Sc3ccc(C=CC(=O)N4CCN(SC(F)(F)F)CC4)c(Cl)c3Cl)c2)CC1 |
| InChI | InChI=1S/C26H26Cl2F3N3O3S2/c27-23-17(5-7-22(35)33-12-14-34(15-13-33)39-26(29,30)31)4-6-21(24(23)28)38-20-3-1-2-19(16-20)32-10-8-18(9-11-32)25(36)37/h1-7,16,18H,8-15H2,(H,36,37) |
| InChIKey | NECQPYGGHONKSW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|