C26H31Cl2N3O2S — CID 59006728
(E)-3-[2,3-dichloro-4-[3-[(1-ethylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 59006728) has the molecular formula C26H31Cl2N3O2S and a molecular weight of 520.53 g/mol. Its IUPAC name is (E)-3-[2,3-dichloro-4-[3-[(1-ethylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[2,3-dichloro-4-[3-[(1-ethylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 59006728 |
| Molecular Formula | C26H31Cl2N3O2S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (E)-3-[2,3-dichloro-4-[3-[(1-ethylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | CCN1CCC(Nc2cccc(Sc3ccc(/C=C/C(=O)N4CCOCC4)c(Cl)c3Cl)c2)CC1 |
| InChI | InChI=1S/C26H31Cl2N3O2S/c1-2-30-12-10-20(11-13-30)29-21-4-3-5-22(18-21)34-23-8-6-19(25(27)26(23)28)7-9-24(32)31-14-16-33-17-15-31/h3-9,18,20,29H,2,10-17H2,1H3/b9-7+ |
| InChIKey | XLBWCXVAXZQRRA-VQHVLOKHSA-N |
| XLogP | 5.91 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|