C25H29Cl2N3O2S — CID 69447082
1-[2,3-dichloro-4-[3-[(1-methylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-3-morpholin-4-ylprop-2-en-1-one (PubChem CID 69447082) has the molecular formula C25H29Cl2N3O2S and a molecular weight of 506.50 g/mol. Its IUPAC name is 1-[2,3-dichloro-4-[3-[(1-methylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-3-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 1-[2,3-dichloro-4-[3-[(1-methylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-3-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 69447082 |
| Molecular Formula | C25H29Cl2N3O2S |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 1-[2,3-dichloro-4-[3-[(1-methylpiperidin-4-yl)amino]phenyl]sulfanylphenyl]-3-morpholin-4-ylprop-2-en-1-one |
| SMILES | CN1CCC(Nc2cccc(Sc3ccc(C(=O)C=CN4CCOCC4)c(Cl)c3Cl)c2)CC1 |
| InChI | InChI=1S/C25H29Cl2N3O2S/c1-29-10-7-18(8-11-29)28-19-3-2-4-20(17-19)33-23-6-5-21(24(26)25(23)27)22(31)9-12-30-13-15-32-16-14-30/h2-6,9,12,17-18,28H,7-8,10-11,13-16H2,1H3 |
| InChIKey | GLPRXHRYWRGXLR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|