C22H19F6NO3S — CID 59006737
(E)-3-[4-[3-(oxan-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 59006737) has the molecular formula C22H19F6NO3S and a molecular weight of 491.45 g/mol. Its IUPAC name is (E)-3-[4-[3-(oxan-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(oxan-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59006737 |
| Molecular Formula | C22H19F6NO3S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (E)-3-[4-[3-(oxan-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Sc2cccc(NC3CCOCC3)c2)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C22H19F6NO3S/c23-21(24,25)19-13(5-7-18(30)31)4-6-17(20(19)22(26,27)28)33-16-3-1-2-15(12-16)29-14-8-10-32-11-9-14/h1-7,12,14,29H,8-11H2,(H,30,31)/b7-5+ |
| InChIKey | ZSYMTDBWSISBPF-FNORWQNLSA-N |
| XLogP | 6.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|