C22H20F6N2O2S — CID 59006859
(E)-3-[4-[3-(piperidin-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 59006859) has the molecular formula C22H20F6N2O2S and a molecular weight of 490.47 g/mol. Its IUPAC name is (E)-3-[4-[3-(piperidin-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(piperidin-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59006859 |
| Molecular Formula | C22H20F6N2O2S |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | (E)-3-[4-[3-(piperidin-4-ylamino)phenyl]sulfanyl-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Sc2cccc(NC3CCNCC3)c2)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C22H20F6N2O2S/c23-21(24,25)19-13(5-7-18(31)32)4-6-17(20(19)22(26,27)28)33-16-3-1-2-15(12-16)30-14-8-10-29-11-9-14/h1-7,12,14,29-30H,8-11H2,(H,31,32)/b7-5+ |
| InChIKey | YEUWXLTWJICHSA-FNORWQNLSA-N |
| XLogP | 6.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|