C23H28Cl2N2O4S — CID 70338693
methyl (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]-methylamino]pent-4-enoate (PubChem CID 70338693) has the molecular formula C23H28Cl2N2O4S and a molecular weight of 499.46 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]-methylamino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]-methylamino]pent-4-enoate |
|---|---|
| PubChem CID | 70338693 |
| Molecular Formula | C23H28Cl2N2O4S |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | methyl (2S)-2-[[1-[(E)-3-(2,3-dichloro-4-methylsulfanylphenyl)prop-2-enoyl]piperidine-4-carbonyl]-methylamino]pent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)OC)N(C)C(=O)C1CCN(C(=O)/C=C/c2ccc(SC)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C23H28Cl2N2O4S/c1-5-6-17(23(30)31-3)26(2)22(29)16-11-13-27(14-12-16)19(28)10-8-15-7-9-18(32-4)21(25)20(15)24/h5,7-10,16-17H,1,6,11-14H2,2-4H3/b10-8+/t17-/m0/s1 |
| InChIKey | CFPRRGJIZCLMMO-VMSUTVGLSA-N |
| XLogP | 4.54 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|