C22H30N2O5 — CID 75535942
methyl 3-ethoxy-2-[methyl-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]propanoate (PubChem CID 75535942) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl 3-ethoxy-2-[methyl-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-ethoxy-2-[methyl-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 75535942 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | methyl 3-ethoxy-2-[methyl-[1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carbonyl]amino]propanoate |
| SMILES | CCOCC(C(=O)OC)N(C)C(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N2O5/c1-4-29-16-19(22(27)28-3)23(2)21(26)18-12-14-24(15-13-18)20(25)11-10-17-8-6-5-7-9-17/h5-11,18-19H,4,12-16H2,1-3H3/b11-10+ |
| InChIKey | OGZMSHPQVLLWSO-ZHACJKMWSA-N |
| XLogP | 1.97 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|