C26H31N3O4 — CID 26355855
N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 26355855) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26355855 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccccc1OC)C(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O4/c1-3-28(19-24(30)27-22-11-7-8-12-23(22)33-2)26(32)21-15-17-29(18-16-21)25(31)14-13-20-9-5-4-6-10-20/h4-14,21H,3,15-19H2,1-2H3,(H,27,30)/b14-13+ |
| InChIKey | CROHZTCQGGIVRT-BUHFOSPRSA-N |
| XLogP | 3.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|