C19H23ClN2O5 — CID 3868733
3-[1-[3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 3868733) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 3-[1-[3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-[3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3868733 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-[1-[3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C=CC(=O)N2CCC(N3CCOC3=O)CC2)c(Cl)c1OC |
| InChI | InChI=1S/C19H23ClN2O5/c1-25-15-5-3-13(17(20)18(15)26-2)4-6-16(23)21-9-7-14(8-10-21)22-11-12-27-19(22)24/h3-6,14H,7-12H2,1-2H3 |
| InChIKey | YEEZZMYPIBYTBG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|