C16H19NO5 — CID 16767189
(E)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 16767189) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (E)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 16767189 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (E)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCCC2)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C16H19NO5/c1-19-12-9-11(5-6-13(18)17-7-3-4-8-17)14(20-2)16-15(12)21-10-22-16/h5-6,9H,3-4,7-8,10H2,1-2H3/b6-5+ |
| InChIKey | DHBSAIRWOGBSFL-AATRIKPKSA-N |
| XLogP | 2.07 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|