C16H20N2O3S — CID 3254480
3-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-oxazinan-2-one (PubChem CID 3254480) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-oxazinan-2-one.
| Compound Name | 3-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 3254480 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]-1,3-oxazinan-2-one |
| SMILES | O=C(C=Cc1cccs1)N1CCC(N2CCCOC2=O)CC1 |
| InChI | InChI=1S/C16H20N2O3S/c19-15(5-4-14-3-1-12-22-14)17-9-6-13(7-10-17)18-8-2-11-21-16(18)20/h1,3-5,12-13H,2,6-11H2 |
| InChIKey | KOAVGNOSANXTBX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|