C12H13NO3S — CID 63007021
1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxylic acid (PubChem CID 63007021) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63007021 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 1-[(E)-3-thiophen-2-ylprop-2-enoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)/C=C/c2cccs2)C1 |
| InChI | InChI=1S/C12H13NO3S/c14-11(4-3-10-2-1-7-17-10)13-6-5-9(8-13)12(15)16/h1-4,7,9H,5-6,8H2,(H,15,16)/b4-3+ |
| InChIKey | HUYFBVOTJLADKB-ONEGZZNKSA-N |
| XLogP | 1.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|