C16H17N3O2S2 — CID 94131967
(3R)-N-(1,3-thiazol-2-yl)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide (PubChem CID 94131967) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is (3R)-N-(1,3-thiazol-2-yl)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1,3-thiazol-2-yl)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94131967 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (3R)-N-(1,3-thiazol-2-yl)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@@H]1CCCN(C(=O)/C=C/c2cccs2)C1 |
| InChI | InChI=1S/C16H17N3O2S2/c20-14(6-5-13-4-2-9-22-13)19-8-1-3-12(11-19)15(21)18-16-17-7-10-23-16/h2,4-7,9-10,12H,1,3,8,11H2,(H,17,18,21)/b6-5+/t12-/m1/s1 |
| InChIKey | HJVYHSHCMNPLAW-BTDICHCPSA-N |
| XLogP | 3.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|