C21H24N4O5S — CID 55813504
1-[(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 55813504) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 1-[(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-[(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55813504 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-[(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | COc1cc(/C=C/C(=O)N2CCCC(C(=O)Nc3nccs3)C2)ccc1OCC(N)=O |
| InChI | InChI=1S/C21H24N4O5S/c1-29-17-11-14(4-6-16(17)30-13-18(22)26)5-7-19(27)25-9-2-3-15(12-25)20(28)24-21-23-8-10-31-21/h4-8,10-11,15H,2-3,9,12-13H2,1H3,(H2,22,26)(H,23,24,28)/b7-5+ |
| InChIKey | WLKLWTZOUJAZCP-FNORWQNLSA-N |
| XLogP | 1.91 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|