C27H32O — CID 134880193
(2E,6E)-4-tert-butyl-3-methyl-2,6-bis[(2-methylphenyl)methylidene]cyclohexan-1-one (PubChem CID 134880193) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is (2E,6E)-4-tert-butyl-3-methyl-2,6-bis[(2-methylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-4-tert-butyl-3-methyl-2,6-bis[(2-methylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 134880193 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (2E,6E)-4-tert-butyl-3-methyl-2,6-bis[(2-methylphenyl)methylidene]cyclohexan-1-one |
| SMILES | Cc1ccccc1/C=C1\CC(C(C)(C)C)C(C)/C(=C\c2ccccc2C)C1=O |
| InChI | InChI=1S/C27H32O/c1-18-11-7-9-13-21(18)15-23-17-25(27(4,5)6)20(3)24(26(23)28)16-22-14-10-8-12-19(22)2/h7-16,20,25H,17H2,1-6H3/b23-15+,24-16+ |
| InChIKey | KTHYEQXRKYNXTH-DFEHQXHXSA-N |
| XLogP | 7.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|