C18H13Cl3N2O2 — CID 7708505
3-chloro-1-[(4-chlorophenyl)methyl]-4-[(2-chlorophenyl)methylimino]pyrrolidine-2,5-dione (PubChem CID 7708505) has the molecular formula C18H13Cl3N2O2 and a molecular weight of 395.67 g/mol. Its IUPAC name is 3-chloro-1-[(4-chlorophenyl)methyl]-4-[(2-chlorophenyl)methylimino]pyrrolidine-2,5-dione.
| Compound Name | 3-chloro-1-[(4-chlorophenyl)methyl]-4-[(2-chlorophenyl)methylimino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7708505 |
| Molecular Formula | C18H13Cl3N2O2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 3-chloro-1-[(4-chlorophenyl)methyl]-4-[(2-chlorophenyl)methylimino]pyrrolidine-2,5-dione |
| SMILES | O=C1/C(=N/Cc2ccccc2Cl)C(Cl)C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl3N2O2/c19-13-7-5-11(6-8-13)10-23-17(24)15(21)16(18(23)25)22-9-12-3-1-2-4-14(12)20/h1-8,15H,9-10H2/b22-16+ |
| InChIKey | RXIPAGCRMUMLBS-CJLVFECKSA-N |
| XLogP | 4.11 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|