C23H17Cl2NO2S2 — CID 98150978
(3S,4S)-1-benzyl-3,4-bis[(4-chlorophenyl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 98150978) has the molecular formula C23H17Cl2NO2S2 and a molecular weight of 474.43 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3,4-bis[(4-chlorophenyl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-1-benzyl-3,4-bis[(4-chlorophenyl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98150978 |
| Molecular Formula | C23H17Cl2NO2S2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | (3S,4S)-1-benzyl-3,4-bis[(4-chlorophenyl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | O=C1[C@H](Sc2ccc(Cl)cc2)[C@@H](Sc2ccc(Cl)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H17Cl2NO2S2/c24-16-6-10-18(11-7-16)29-20-21(30-19-12-8-17(25)9-13-19)23(28)26(22(20)27)14-15-4-2-1-3-5-15/h1-13,20-21H,14H2/t20-,21-/m1/s1 |
| InChIKey | CGAFHOTUXQPNQZ-NHCUHLMSSA-N |
| XLogP | 6.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|