C13H8Cl3NO2 — CID 163149139
5-benzylimino-2,3,6-trichlorocyclohex-2-ene-1,4-dione (PubChem CID 163149139) has the molecular formula C13H8Cl3NO2 and a molecular weight of 316.57 g/mol. Its IUPAC name is 5-benzylimino-2,3,6-trichlorocyclohex-2-ene-1,4-dione.
| Compound Name | 5-benzylimino-2,3,6-trichlorocyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 163149139 |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 5-benzylimino-2,3,6-trichlorocyclohex-2-ene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C(Cl)/C1=N/Cc1ccccc1 |
| InChI | InChI=1S/C13H8Cl3NO2/c14-8-9(15)13(19)11(10(16)12(8)18)17-6-7-4-2-1-3-5-7/h1-5,10H,6H2/b17-11- |
| InChIKey | MRSZCEJYXJWHIC-BOPFTXTBSA-N |
| XLogP | 3.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|