C16H15FN4O — CID 137129940
4-benzylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one (PubChem CID 137129940) has the molecular formula C16H15FN4O and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-benzylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one.
| Compound Name | 4-benzylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 137129940 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-benzylimino-6-(4-fluorophenyl)-1,3,5-triazinan-2-one |
| SMILES | O=C1N/C(=N\Cc2ccccc2)NC(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C16H15FN4O/c17-13-8-6-12(7-9-13)14-19-15(21-16(22)20-14)18-10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H3,18,19,20,21,22) |
| InChIKey | QNLFKEWBHVIXHJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|