C14H15N3O2 — CID 135416868
2-benzylimino-5-prop-2-enyl-1,3-diazinane-4,6-dione (PubChem CID 135416868) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-benzylimino-5-prop-2-enyl-1,3-diazinane-4,6-dione.
| Compound Name | 2-benzylimino-5-prop-2-enyl-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 135416868 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-benzylimino-5-prop-2-enyl-1,3-diazinane-4,6-dione |
| SMILES | C=CCC1C(=O)NC(=NCc2ccccc2)NC1=O |
| InChI | InChI=1S/C14H15N3O2/c1-2-6-11-12(18)16-14(17-13(11)19)15-9-10-7-4-3-5-8-10/h2-5,7-8,11H,1,6,9H2,(H2,15,16,17,18,19) |
| InChIKey | QQKQHLFZGJBZSW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|