C24H26N6 — CID 154502942
2-benzyl-4,6-bis(benzylimino)-1,3,5-triazinan-2-amine (PubChem CID 154502942) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-benzyl-4,6-bis(benzylimino)-1,3,5-triazinan-2-amine.
| Compound Name | 2-benzyl-4,6-bis(benzylimino)-1,3,5-triazinan-2-amine |
|---|---|
| PubChem CID | 154502942 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-benzyl-4,6-bis(benzylimino)-1,3,5-triazinan-2-amine |
| SMILES | NC1(Cc2ccccc2)N/C(=N/Cc2ccccc2)N/C(=N\Cc2ccccc2)N1 |
| InChI | InChI=1S/C24H26N6/c25-24(16-19-10-4-1-5-11-19)29-22(26-17-20-12-6-2-7-13-20)28-23(30-24)27-18-21-14-8-3-9-15-21/h1-15H,16-18,25H2,(H3,26,27,28,29,30) |
| InChIKey | AVCPJZBLHUSQSY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|