C12H14N2OS — CID 137289996
2-benzylimino-5-ethyl-1,3-thiazolidin-4-one (PubChem CID 137289996) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-benzylimino-5-ethyl-1,3-thiazolidin-4-one.
| Compound Name | 2-benzylimino-5-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137289996 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-benzylimino-5-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCC1S/C(=N/Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C12H14N2OS/c1-2-10-11(15)14-12(16-10)13-8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,13,14,15) |
| InChIKey | NYCFQJSXOFIVJF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|