C16H22N2OS — CID 137292329
2-benzylimino-5-hexyl-1,3-thiazolidin-4-one (PubChem CID 137292329) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-benzylimino-5-hexyl-1,3-thiazolidin-4-one.
| Compound Name | 2-benzylimino-5-hexyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137292329 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-benzylimino-5-hexyl-1,3-thiazolidin-4-one |
| SMILES | CCCCCCC1S/C(=N/Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C16H22N2OS/c1-2-3-4-8-11-14-15(19)18-16(20-14)17-12-13-9-6-5-7-10-13/h5-7,9-10,14H,2-4,8,11-12H2,1H3,(H,17,18,19) |
| InChIKey | UJMYEIURVVLDRM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|