C23H26IN3O4S2 — CID 171977250
[2-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-iodobenzenesulfonate (PubChem CID 171977250) has the molecular formula C23H26IN3O4S2 and a molecular weight of 599.52 g/mol. Its IUPAC name is [2-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-iodobenzenesulfonate.
| Compound Name | [2-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-iodobenzenesulfonate |
|---|---|
| PubChem CID | 171977250 |
| Molecular Formula | C23H26IN3O4S2 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 599.04 |
| IUPAC Name | [2-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-iodobenzenesulfonate |
| SMILES | CCCCCCCC1S/C(=N/N=C/c2ccccc2OS(=O)(=O)c2ccc(I)cc2)NC1=O |
| InChI | InChI=1S/C23H26IN3O4S2/c1-2-3-4-5-6-11-21-22(28)26-23(32-21)27-25-16-17-9-7-8-10-20(17)31-33(29,30)19-14-12-18(24)13-15-19/h7-10,12-16,21H,2-6,11H2,1H3,(H,26,27,28)/b25-16+ |
| InChIKey | QXULVHXBSSFYBJ-PCLIKHOPSA-N |
| XLogP | 5.34 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|