C19H17Cl2N3O4S2 — CID 137231591
[2-[[[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 137231591) has the molecular formula C19H17Cl2N3O4S2 and a molecular weight of 486.40 g/mol. Its IUPAC name is [2-[[[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-[[[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 137231591 |
| Molecular Formula | C19H17Cl2N3O4S2 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | [2-[[[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCC[C@@H]1SC(=NN=Cc2ccccc2OS(=O)(=O)c2ccc(Cl)c(Cl)c2)NC1=O |
| InChI | InChI=1S/C19H17Cl2N3O4S2/c1-2-5-17-18(25)23-19(29-17)24-22-11-12-6-3-4-7-16(12)28-30(26,27)13-8-9-14(20)15(21)10-13/h3-4,6-11,17H,2,5H2,1H3,(H,23,24,25)/t17-/m0/s1 |
| InChIKey | YLJWQLIHRXFTBY-KRWDZBQOSA-N |
| XLogP | 4.48 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|