C19H19N3O4S2 — CID 135893361
[3-[(Z)-[(Z)-[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 135893361) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is [3-[(Z)-[(Z)-[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [3-[(Z)-[(Z)-[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 135893361 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [3-[(Z)-[(Z)-[(5S)-4-oxo-5-propyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | CCC[C@@H]1S/C(=N\N=C/c2cccc(OS(=O)(=O)c3ccccc3)c2)NC1=O |
| InChI | InChI=1S/C19H19N3O4S2/c1-2-7-17-18(23)21-19(27-17)22-20-13-14-8-6-9-15(12-14)26-28(24,25)16-10-4-3-5-11-16/h3-6,8-13,17H,2,7H2,1H3,(H,21,22,23)/b20-13-/t17-/m0/s1 |
| InChIKey | JWLGUMOAQBPQKA-IZQLPPHKSA-N |
| XLogP | 3.18 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|