C21H19N3OS — CID 135852394
(2E,5S)-2-[(Z)-anthracen-9-ylmethylidenehydrazinylidene]-5-propyl-1,3-thiazolidin-4-one (PubChem CID 135852394) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (2E,5S)-2-[(Z)-anthracen-9-ylmethylidenehydrazinylidene]-5-propyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-2-[(Z)-anthracen-9-ylmethylidenehydrazinylidene]-5-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135852394 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2E,5S)-2-[(Z)-anthracen-9-ylmethylidenehydrazinylidene]-5-propyl-1,3-thiazolidin-4-one |
| SMILES | CCC[C@@H]1S/C(=N/N=C\c2c3ccccc3cc3ccccc23)NC1=O |
| InChI | InChI=1S/C21H19N3OS/c1-2-7-19-20(25)23-21(26-19)24-22-13-18-16-10-5-3-8-14(16)12-15-9-4-6-11-17(15)18/h3-6,8-13,19H,2,7H2,1H3,(H,23,24,25)/b22-13-/t19-/m0/s1 |
| InChIKey | YBCZMHYRCKZOFD-CVHFWEDTSA-N |
| XLogP | 4.71 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|