C27H35N3O4S2 — CID 136911566
[4-[(Z)-[(Z)-[(5R)-5-decyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 136911566) has the molecular formula C27H35N3O4S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is [4-[(Z)-[(Z)-[(5R)-5-decyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-[(Z)-[(5R)-5-decyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 136911566 |
| Molecular Formula | C27H35N3O4S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [4-[(Z)-[(Z)-[(5R)-5-decyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCCCCCCCCC[C@H]1S/C(=N\N=C/c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)NC1=O |
| InChI | InChI=1S/C27H35N3O4S2/c1-3-4-5-6-7-8-9-10-11-25-26(31)29-27(35-25)30-28-20-22-14-16-23(17-15-22)34-36(32,33)24-18-12-21(2)13-19-24/h12-20,25H,3-11H2,1-2H3,(H,29,30,31)/b28-20-/t25-/m1/s1 |
| InChIKey | HAJKSKCDZIVCMR-AFXLCRDISA-N |
| XLogP | 6.22 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|