C25H31N3O5S2 — CID 171977257
[4-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 171977257) has the molecular formula C25H31N3O5S2 and a molecular weight of 517.67 g/mol. Its IUPAC name is [4-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171977257 |
| Molecular Formula | C25H31N3O5S2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | [4-[(E)-[(E)-(5-heptyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | CCCCCCCC1S/C(=N/N=C/c2ccc(OS(=O)(=O)c3ccc(C)cc3)c(OC)c2)NC1=O |
| InChI | InChI=1S/C25H31N3O5S2/c1-4-5-6-7-8-9-23-24(29)27-25(34-23)28-26-17-19-12-15-21(22(16-19)32-3)33-35(30,31)20-13-10-18(2)11-14-20/h10-17,23H,4-9H2,1-3H3,(H,27,28,29)/b26-17+ |
| InChIKey | FHKOQCXKWNUPQT-YZSQISJMSA-N |
| XLogP | 5.05 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|