C19H18ClN3O4S2 — CID 135625976
[2-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3-chloro-4-methylbenzenesulfonate (PubChem CID 135625976) has the molecular formula C19H18ClN3O4S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is [2-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3-chloro-4-methylbenzenesulfonate.
| Compound Name | [2-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3-chloro-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135625976 |
| Molecular Formula | C19H18ClN3O4S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | [2-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3-chloro-4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2/C=N\N=C2\NC(=O)C(C)(C)S2)cc1Cl |
| InChI | InChI=1S/C19H18ClN3O4S2/c1-12-8-9-14(10-15(12)20)29(25,26)27-16-7-5-4-6-13(16)11-21-23-18-22-17(24)19(2,3)28-18/h4-11H,1-3H3,(H,22,23,24)/b21-11- |
| InChIKey | LSADTPFJTSCHDP-NHDPSOOVSA-N |
| XLogP | 3.75 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|