C18H15Cl2N3O4S2 — CID 135794707
[2-methyl-6-[[(E)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 135794707) has the molecular formula C18H15Cl2N3O4S2 and a molecular weight of 472.38 g/mol. Its IUPAC name is [2-methyl-6-[[(E)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-methyl-6-[[(E)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 135794707 |
| Molecular Formula | C18H15Cl2N3O4S2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | [2-methyl-6-[[(E)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | Cc1cccc(C=N/N=C2\NC(=O)C(C)S2)c1OS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3O4S2/c1-10-4-3-5-12(9-21-23-18-22-17(24)11(2)28-18)16(10)27-29(25,26)13-6-7-14(19)15(20)8-13/h3-9,11H,1-2H3,(H,22,23,24) |
| InChIKey | ARQZOOLNYUMIMN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|