C20H21N3O5S2 — CID 135537956
[2-methyl-6-[[(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-ethoxybenzenesulfonate (PubChem CID 135537956) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is [2-methyl-6-[[(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-ethoxybenzenesulfonate.
| Compound Name | [2-methyl-6-[[(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-ethoxybenzenesulfonate |
|---|---|
| PubChem CID | 135537956 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [2-methyl-6-[[(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-ethoxybenzenesulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2c(C)cccc2C=NN=C2NC(=O)C(C)S2)cc1 |
| InChI | InChI=1S/C20H21N3O5S2/c1-4-27-16-8-10-17(11-9-16)30(25,26)28-18-13(2)6-5-7-15(18)12-21-23-20-22-19(24)14(3)29-20/h5-12,14H,4H2,1-3H3,(H,22,23,24) |
| InChIKey | BCICZDFNYUJICJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|