C19H19N3O5S2 — CID 135588499
[4-methyl-2-[(E)-[(Z)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 135588499) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is [4-methyl-2-[(E)-[(Z)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-methyl-2-[(E)-[(Z)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 135588499 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [4-methyl-2-[(E)-[(Z)-(5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc(C)cc2/C=N/N=C2/NC(=O)C(C)S2)cc1 |
| InChI | InChI=1S/C19H19N3O5S2/c1-12-4-9-17(27-29(24,25)16-7-5-15(26-3)6-8-16)14(10-12)11-20-22-19-21-18(23)13(2)28-19/h4-11,13H,1-3H3,(H,21,22,23)/b20-11+ |
| InChIKey | SLVUBFKFXXTVPX-RGVLZGJSSA-N |
| XLogP | 2.71 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|