C18H15Br2N3O4S2 — CID 135682619
[4-methyl-2-[(Z)-[(E)-[(5R)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate (PubChem CID 135682619) has the molecular formula C18H15Br2N3O4S2 and a molecular weight of 561.28 g/mol. Its IUPAC name is [4-methyl-2-[(Z)-[(E)-[(5R)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate.
| Compound Name | [4-methyl-2-[(Z)-[(E)-[(5R)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 135682619 |
| Molecular Formula | C18H15Br2N3O4S2 |
| Molecular Weight | 561.28 g/mol |
| Exact Mass | 558.89 |
| IUPAC Name | [4-methyl-2-[(Z)-[(E)-[(5R)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2cc(Br)ccc2Br)c(/C=N\N=C2/NC(=O)[C@@H](C)S2)c1 |
| InChI | InChI=1S/C18H15Br2N3O4S2/c1-10-3-6-15(27-29(25,26)16-8-13(19)4-5-14(16)20)12(7-10)9-21-23-18-22-17(24)11(2)28-18/h3-9,11H,1-2H3,(H,22,23,24)/b21-9-/t11-/m1/s1 |
| InChIKey | NVFLKMYWFVIMKA-LBUZSKGWSA-N |
| XLogP | 4.23 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|