C21H23N3O4S2 — CID 135951009
[2-methyl-6-[(Z)-[(E)-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 135951009) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is [2-methyl-6-[(Z)-[(E)-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-methyl-6-[(Z)-[(E)-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 135951009 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [2-methyl-6-[(Z)-[(E)-[(5S)-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2c(C)cccc2/C=N\N=C2/NC(=O)[C@H](C)S2)c(C)c1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-12-9-14(3)19(15(4)10-12)30(26,27)28-18-13(2)7-6-8-17(18)11-22-24-21-23-20(25)16(5)29-21/h6-11,16H,1-5H3,(H,23,24,25)/b22-11-/t16-/m0/s1 |
| InChIKey | LAOBZASXNHVEIP-VBHHZLGVSA-N |
| XLogP | 3.63 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|