C21H22N4O5S2 — CID 135407483
[2-[[(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-4-methylphenyl] 4-acetamidobenzenesulfonate (PubChem CID 135407483) has the molecular formula C21H22N4O5S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-[[(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-4-methylphenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[[(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-4-methylphenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 135407483 |
| Molecular Formula | C21H22N4O5S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | [2-[[(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]-4-methylphenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(C)cc2C=NN=C2NC(=O)C(C)(C)S2)cc1 |
| InChI | InChI=1S/C21H22N4O5S2/c1-13-5-10-18(15(11-13)12-22-25-20-24-19(27)21(3,4)31-20)30-32(28,29)17-8-6-16(7-9-17)23-14(2)26/h5-12H,1-4H3,(H,23,26)(H,24,25,27) |
| InChIKey | UCRIXODUWSQURD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|