C22H37N5 — CID 135931710
6,6-dimethyl-4-N-nonyl-2-N-(2-phenylethyl)-1,3,5-triazinane-2,4-diimine (PubChem CID 135931710) has the molecular formula C22H37N5 and a molecular weight of 371.57 g/mol. Its IUPAC name is 6,6-dimethyl-4-N-nonyl-2-N-(2-phenylethyl)-1,3,5-triazinane-2,4-diimine.
| Compound Name | 6,6-dimethyl-4-N-nonyl-2-N-(2-phenylethyl)-1,3,5-triazinane-2,4-diimine |
|---|---|
| PubChem CID | 135931710 |
| Molecular Formula | C22H37N5 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | 6,6-dimethyl-4-N-nonyl-2-N-(2-phenylethyl)-1,3,5-triazinane-2,4-diimine |
| SMILES | CCCCCCCCC/N=C1\N/C(=N\CCc2ccccc2)NC(C)(C)N1 |
| InChI | InChI=1S/C22H37N5/c1-4-5-6-7-8-9-13-17-23-20-25-21(27-22(2,3)26-20)24-18-16-19-14-11-10-12-15-19/h10-12,14-15H,4-9,13,16-18H2,1-3H3,(H3,23,24,25,26,27) |
| InChIKey | RYVOVQWSDZKQDL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|