C24H41N5O2 — CID 135931742
acetic acid;6,6-dimethyl-2-N-[(4-methylphenyl)methyl]-4-N-nonyl-1,3,5-triazinane-2,4-diimine (PubChem CID 135931742) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is acetic acid;6,6-dimethyl-2-N-[(4-methylphenyl)methyl]-4-N-nonyl-1,3,5-triazinane-2,4-diimine.
| Compound Name | acetic acid;6,6-dimethyl-2-N-[(4-methylphenyl)methyl]-4-N-nonyl-1,3,5-triazinane-2,4-diimine |
|---|---|
| PubChem CID | 135931742 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | acetic acid;6,6-dimethyl-2-N-[(4-methylphenyl)methyl]-4-N-nonyl-1,3,5-triazinane-2,4-diimine |
| SMILES | CC(=O)O.CCCCCCCCC/N=C1\N/C(=N\Cc2ccc(C)cc2)NC(C)(C)N1 |
| InChI | InChI=1S/C22H37N5.C2H4O2/c1-5-6-7-8-9-10-11-16-23-20-25-21(27-22(3,4)26-20)24-17-19-14-12-18(2)13-15-19;1-2(3)4/h12-15H,5-11,16-17H2,1-4H3,(H3,23,24,25,26,27);1H3,(H,3,4) |
| InChIKey | YDYQZHZWMUMUCA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|