C19H20FN3O2 — CID 58122433
2-benzylimino-3-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-1,3-diazinan-4-one (PubChem CID 58122433) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-benzylimino-3-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-1,3-diazinan-4-one.
| Compound Name | 2-benzylimino-3-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 58122433 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-benzylimino-3-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-1,3-diazinan-4-one |
| SMILES | CN1CC(O)C(=O)N(Cc2ccc(F)cc2)/C1=N/Cc1ccccc1 |
| InChI | InChI=1S/C19H20FN3O2/c1-22-13-17(24)18(25)23(12-15-7-9-16(20)10-8-15)19(22)21-11-14-5-3-2-4-6-14/h2-10,17,24H,11-13H2,1H3/b21-19+ |
| InChIKey | ZEMYPNHUVKSJGJ-XUTLUUPISA-N |
| XLogP | 2.02 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|