C25H22ClN3 — CID 163629733
(4R,5S)-N-benzyl-4-(4-chlorophenyl)-5-[4-(cyclopropen-1-yl)phenyl]imidazolidin-2-imine (PubChem CID 163629733) has the molecular formula C25H22ClN3 and a molecular weight of 399.93 g/mol. Its IUPAC name is (4R,5S)-N-benzyl-4-(4-chlorophenyl)-5-[4-(cyclopropen-1-yl)phenyl]imidazolidin-2-imine.
| Compound Name | (4R,5S)-N-benzyl-4-(4-chlorophenyl)-5-[4-(cyclopropen-1-yl)phenyl]imidazolidin-2-imine |
|---|---|
| PubChem CID | 163629733 |
| Molecular Formula | C25H22ClN3 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (4R,5S)-N-benzyl-4-(4-chlorophenyl)-5-[4-(cyclopropen-1-yl)phenyl]imidazolidin-2-imine |
| SMILES | Clc1ccc([C@H]2N/C(=N\Cc3ccccc3)N[C@H]2c2ccc(C3=CC3)cc2)cc1 |
| InChI | InChI=1S/C25H22ClN3/c26-22-14-12-21(13-15-22)24-23(20-10-8-19(9-11-20)18-6-7-18)28-25(29-24)27-16-17-4-2-1-3-5-17/h1-6,8-15,23-24H,7,16H2,(H2,27,28,29)/t23-,24+/m0/s1 |
| InChIKey | HVAYMNPYOGTIRU-BJKOFHAPSA-N |
| XLogP | 5.66 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|