C22H19F2N3 — CID 135412930
(4R,5S)-N-[(3,4-difluorophenyl)methyl]-4,5-diphenylimidazolidin-2-imine (PubChem CID 135412930) has the molecular formula C22H19F2N3 and a molecular weight of 363.41 g/mol. Its IUPAC name is (4R,5S)-N-[(3,4-difluorophenyl)methyl]-4,5-diphenylimidazolidin-2-imine.
| Compound Name | (4R,5S)-N-[(3,4-difluorophenyl)methyl]-4,5-diphenylimidazolidin-2-imine |
|---|---|
| PubChem CID | 135412930 |
| Molecular Formula | C22H19F2N3 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (4R,5S)-N-[(3,4-difluorophenyl)methyl]-4,5-diphenylimidazolidin-2-imine |
| SMILES | Fc1ccc(C/N=C2\N[C@H](c3ccccc3)[C@H](c3ccccc3)N2)cc1F |
| InChI | InChI=1S/C22H19F2N3/c23-18-12-11-15(13-19(18)24)14-25-22-26-20(16-7-3-1-4-8-16)21(27-22)17-9-5-2-6-10-17/h1-13,20-21H,14H2,(H2,25,26,27)/t20-,21+ |
| InChIKey | HVJXRHVKAZCMCS-OYRHEFFESA-N |
| XLogP | 4.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|