C15H15F2N3 — CID 51131588
1-benzyl-2-[(3,4-difluorophenyl)methyl]guanidine (PubChem CID 51131588) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-benzyl-2-[(3,4-difluorophenyl)methyl]guanidine.
| Compound Name | 1-benzyl-2-[(3,4-difluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 51131588 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-benzyl-2-[(3,4-difluorophenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(F)c(F)c1)NCc1ccccc1 |
| InChI | InChI=1S/C15H15F2N3/c16-13-7-6-12(8-14(13)17)10-20-15(18)19-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H3,18,19,20) |
| InChIKey | CYTPCQJEOXIUAU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|