C14H10ClNO6 — CID 7068180
(2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]butanedioic acid (PubChem CID 7068180) has the molecular formula C14H10ClNO6 and a molecular weight of 323.69 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]butanedioic acid.
| Compound Name | (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]butanedioic acid |
|---|---|
| PubChem CID | 7068180 |
| Molecular Formula | C14H10ClNO6 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](/N=C1/C(=O)c2ccccc2C(=O)C1Cl)C(=O)O |
| InChI | InChI=1S/C14H10ClNO6/c15-10-11(16-8(14(21)22)5-9(17)18)13(20)7-4-2-1-3-6(7)12(10)19/h1-4,8,10H,5H2,(H,17,18)(H,21,22)/b16-11+/t8-,10?/m1/s1 |
| InChIKey | UMQDHSMDZDHFMU-NVDMKPCYSA-N |
| XLogP | 1.04 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|