C19H14ClNO4 — CID 7421546
(2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-phenylpropanoic acid (PubChem CID 7421546) has the molecular formula C19H14ClNO4 and a molecular weight of 355.78 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 7421546 |
| Molecular Formula | C19H14ClNO4 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-phenylpropanoic acid |
| SMILES | O=C1/C(=N/[C@@H](Cc2ccccc2)C(=O)O)C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H14ClNO4/c20-15-16(18(23)13-9-5-4-8-12(13)17(15)22)21-14(19(24)25)10-11-6-2-1-3-7-11/h1-9,14-15H,10H2,(H,24,25)/b21-16+/t14-,15?/m0/s1 |
| InChIKey | IIQAIAJMNTUIPZ-LTSMVZQUSA-N |
| XLogP | 2.81 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|