C21H15ClN2O4 — CID 7068208
(2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 7068208) has the molecular formula C21H15ClN2O4 and a molecular weight of 394.81 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 7068208 |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C1/C(=N/[C@H](Cc2c[nH]c3ccccc23)C(=O)O)C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H15ClN2O4/c22-17-18(20(26)14-7-2-1-6-13(14)19(17)25)24-16(21(27)28)9-11-10-23-15-8-4-3-5-12(11)15/h1-8,10,16-17,23H,9H2,(H,27,28)/b24-18+/t16-,17?/m1/s1 |
| InChIKey | MTMVUWNZIGGWJD-OYHCCHKSSA-N |
| XLogP | 3.29 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|