C23H21N3OS — CID 12896086
2,4-dibenzyl-5-benzylimino-1,2,4-thiadiazolidin-3-one (PubChem CID 12896086) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 2,4-dibenzyl-5-benzylimino-1,2,4-thiadiazolidin-3-one.
| Compound Name | 2,4-dibenzyl-5-benzylimino-1,2,4-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 12896086 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2,4-dibenzyl-5-benzylimino-1,2,4-thiadiazolidin-3-one |
| SMILES | O=c1n(Cc2ccccc2)s/c(=N\Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H21N3OS/c27-23-25(17-20-12-6-2-7-13-20)22(24-16-19-10-4-1-5-11-19)28-26(23)18-21-14-8-3-9-15-21/h1-15H,16-18H2/b24-22- |
| InChIKey | PWWPNJSZPKLMIC-GYHWCHFESA-N |
| XLogP | 3.91 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|