C12H12N2O2S — CID 56673933
4-benzyl-2-prop-2-enyl-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 56673933) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-benzyl-2-prop-2-enyl-1,2,4-thiadiazolidine-3,5-dione.
| Compound Name | 4-benzyl-2-prop-2-enyl-1,2,4-thiadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 56673933 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-benzyl-2-prop-2-enyl-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | C=CCn1sc(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C12H12N2O2S/c1-2-8-14-11(15)13(12(16)17-14)9-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
| InChIKey | NDFCDLFFSZZLDR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|